CAS 1196074-44-8

4,5-Diamino-2-methoxybenzonitrile

Description:

4,5-Diamino-2-methoxybenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two amino groups and a methoxy group, as well as a nitrile functional group. The presence of the amino groups contributes to its potential as a building block in the synthesis of various pharmaceuticals and agrochemicals, as they can participate in nucleophilic reactions. The methoxy group enhances the compound's solubility and can influence its electronic properties, making it a useful intermediate in organic synthesis. The nitrile group adds to the compound's reactivity, allowing for further functionalization. This compound is typically solid at room temperature and may exhibit moderate to high polarity due to the presence of the amino and methoxy groups. Its applications may extend to fields such as medicinal chemistry, where it could serve as a precursor for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₈H₉N₃O

InChI: InChI=1S/C8H9N3O/c1-12-8-3-7(11)6(10)2-5(8)4-9/h2-3H,10-11H2,1H3

InChI key: InChIKey=DJMJYHUUAPNGMO-UHFFFAOYSA-N

SMILES: C(#N)C1=C(OC)C=C(N)C(N)=C1

Synonyms:

• Benzonitrile, 4,5-diamino-2-methoxy-
• 4,5-Diamino-2-methoxybenzonitrile