CAS 1196109-53-1

4-[[3-[(5-Ethynyl-2-pyridinyl)oxy]phenyl]methyl]-N-3-pyridinyl-1-piperidinecarboxamide

Description:

The chemical substance known as 4-[[3-[(5-Ethynyl-2-pyridinyl)oxy]phenyl]methyl]-N-3-pyridinyl-1-piperidinecarboxamide, with the CAS number 1196109-53-1, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and functional groups. This compound features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is substituted with a carboxamide group, contributing to its potential biological activity. The presence of ethynyl and pyridine moieties suggests that it may exhibit interesting electronic properties and could interact with biological targets, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, due to the presence of polar functional groups. Additionally, the compound's potential applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and mechanism of action. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₂₅H₂₄N₄O₂

InChI: InChI=1S/C25H24N4O2/c1-2-19-8-9-24(27-17-19)31-23-7-3-5-21(16-23)15-20-10-13-29(14-11-20)25(30)28-22-6-4-12-26-18-22/h1,3-9,12,16-18,20H,10-11,13-15H2,(H,28,30)

InChI key: InChIKey=YOUNTNMKNQNFDV-UHFFFAOYSA-N

SMILES: C(NC=1C=CC=NC1)(=O)N2CCC(CC3=CC(OC4=CC=C(C#C)C=N4)=CC=C3)CC2

Synonyms:

• 4-[[3-[(5-Ethynyl-2-pyridinyl)oxy]phenyl]methyl]-N-3-pyridinyl-1-piperidinecarboxamide
• 1-Piperidinecarboxamide, 4-[[3-[(5-ethynyl-2-pyridinyl)oxy]phenyl]methyl]-N-3-pyridinyl-
• PF 3845yne

PF3845yne

CAS: 1196109-53-1

PF3845yne is an alkyne analogue of PF-3845 maintaining high potency for FAAH.

Formula: C₂₅H₂₄N₄O₂

Color and Shape: Solid

Molecular weight: 412.48

Ref: TM-T33953