CAS 1196145-18-2

1H-Pyrrolo[3,2-b]pyridine-3-methanamine

Description:

1H-Pyrrolo[3,2-b]pyridine-3-methanamine, identified by its CAS number 1196145-18-2, is a heterocyclic organic compound featuring a fused pyrrole and pyridine structure. This compound typically exhibits characteristics common to nitrogen-containing heterocycles, such as potential basicity due to the presence of nitrogen atoms in its rings. It may display moderate solubility in polar solvents, influenced by its functional groups, and can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The presence of the methanamine group suggests that it may act as a primary amine, allowing for further derivatization and reactivity. Compounds of this type are often of interest in medicinal chemistry due to their potential biological activity, including roles as enzyme inhibitors or receptor modulators. Additionally, the structural features may contribute to unique electronic properties, making them suitable for applications in materials science or organic electronics. As with many heterocycles, the specific reactivity and properties can vary significantly based on the surrounding chemical environment and substituents.

Formula: C₈H₉N₃

InChI: InChI=1S/C8H9N3/c9-4-6-5-11-7-2-1-3-10-8(6)7/h1-3,5,11H,4,9H2

InChI key: InChIKey=CCLMUTSOQIAOIW-UHFFFAOYSA-N

SMILES: C(N)C=1C=2C(NC1)=CC=CN2

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-3-methanamine