CymitQuimica logo

CAS 1196145-30-8

:

3-Bromo-7,8-dihydro-5H-pyrano[4,3-b]pyridine

Description:
3-Bromo-7,8-dihydro-5H-pyrano[4,3-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyridine ring fused to a pyran ring. This compound features a bromine substituent at the 3-position, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the dihydro group indicates that the compound has two hydrogen atoms added to the pyran ring, which can influence its stability and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in drug discovery and development. The molecular structure allows for various functionalization possibilities, which can enhance its pharmacological properties. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of the bromine atom. Overall, 3-Bromo-7,8-dihydro-5H-pyrano[4,3-b]pyridine represents a class of compounds that can be explored for their potential therapeutic applications.
Formula:C8H8BrNO
InChI:InChI=1S/C8H8BrNO/c9-7-3-6-5-11-2-1-8(6)10-4-7/h3-4H,1-2,5H2
InChI key:InChIKey=CDDWBPZPCMZPOT-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(=NC1)CCOC2
Synonyms:
  • 5H-Pyrano[4,3-b]pyridine, 3-bromo-7,8-dihydro-
  • 3-Bromo-7,8-dihydro-5H-pyrano[4,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.