CAS 1196145-67-1

2-Chloro-5-pyrimidinemethanesulfonyl chloride

Description:

2-Chloro-5-pyrimidinemethanesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a pyrimidine ring, a six-membered aromatic heterocycle containing nitrogen atoms, which contributes to its biological activity and potential applications in pharmaceuticals. The presence of the chloro substituent enhances its electrophilic properties, making it a useful intermediate in the synthesis of various organic compounds. Typically, sulfonyl chlorides are utilized in the preparation of sulfonamides and other derivatives, and they can participate in nucleophilic substitution reactions. The compound is likely to be a solid at room temperature and may require careful handling due to its reactive nature, particularly with water and amines, which can lead to hydrolysis or formation of sulfonamides. Safety precautions should be taken when working with this substance, as it may pose health hazards such as skin and respiratory irritation. Overall, 2-Chloro-5-pyrimidinemethanesulfonyl chloride is a valuable reagent in synthetic organic chemistry.

Formula: C₅H₄Cl₂N₂O₂S

InChI: InChI=1S/C5H4Cl2N2O2S/c6-5-8-1-4(2-9-5)3-12(7,10)11/h1-2H,3H2

InChI key: InChIKey=WSEBYCPASFXAKS-UHFFFAOYSA-N

SMILES: C(S(Cl)(=O)=O)C=1C=NC(Cl)=NC1

Synonyms:

• 5-Pyrimidinemethanesulfonyl chloride, 2-chloro-
• 2-Chloro-5-pyrimidinemethanesulfonyl chloride