CymitQuimica logo

CAS 1196146-01-6

:

5-Methoxy-2-pyrazinemethanesulfonyl chloride

Description:
5-Methoxy-2-pyrazinemethanesulfonyl chloride is a chemical compound characterized by its unique structure, which includes a pyrazine ring and a sulfonyl chloride functional group. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the methoxy group enhances its reactivity and solubility in organic solvents, making it a valuable intermediate in various chemical reactions. As a sulfonyl chloride, it is known for its ability to act as a sulfonating agent, facilitating the introduction of sulfonyl groups into other organic molecules. The compound is likely to be sensitive to moisture and should be handled with care, as sulfonyl chlorides can release hydrochloric acid upon hydrolysis. Safety precautions are essential when working with this substance due to its potential irritant properties. Overall, 5-Methoxy-2-pyrazinemethanesulfonyl chloride is a versatile reagent in synthetic chemistry, contributing to the formation of complex molecular architectures.
Formula:C6H7ClN2O3S
InChI:InChI=1S/C6H7ClN2O3S/c1-12-6-3-8-5(2-9-6)4-13(7,10)11/h2-3H,4H2,1H3
InChI key:InChIKey=VDOSJFJIAPUJFX-UHFFFAOYSA-N
SMILES:C(S(Cl)(=O)=O)C=1C=NC(OC)=CN1
Synonyms:
  • 2-Pyrazinemethanesulfonyl chloride, 5-methoxy-
  • 5-Methoxy-2-pyrazinemethanesulfonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.