CAS 1196146-14-1
:Ethyl 4-bromo-6-(trifluoromethyl)-3-pyridinecarboxylate
Description:
Ethyl 4-bromo-6-(trifluoromethyl)-3-pyridinecarboxylate is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a trifluoromethyl group at the 6-position significantly influences its reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, such as ethanol and dichloromethane, but has limited solubility in water due to its hydrophobic characteristics. The ethyl ester functional group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the trifluoromethyl group enhances its lipophilicity and may impart unique biological activities, making it of interest in medicinal chemistry and agrochemical applications. Safety precautions should be observed when handling this compound, as it may pose health risks due to its halogenated nature.
Formula:C9H7BrF3NO2
InChI:InChI=1S/C9H7BrF3NO2/c1-2-16-8(15)5-4-14-7(3-6(5)10)9(11,12)13/h3-4H,2H2,1H3
InChI key:InChIKey=QMFXUMLHKBTNII-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(Br)=CC(C(F)(F)F)=NC1
Synonyms:- 3-Pyridinecarboxylic acid, 4-bromo-6-(trifluoromethyl)-, ethyl ester
- Ethyl 4-bromo-6-(trifluoromethyl)-3-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
