
CAS 1196146-21-0
:2-Pyrimidinemethanamine, 4-(dimethylamino)-, hydrochloride (1:1)
Description:
2-Pyrimidinemethanamine, 4-(dimethylamino)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. This substance features a dimethylamino group, which enhances its basicity and solubility in polar solvents. As a hydrochloride salt, it is typically encountered in a crystalline form, which aids in its stability and handling. The presence of the hydrochloride indicates that the compound is protonated, making it more soluble in water compared to its free base form. This compound may exhibit biological activity, potentially acting as a ligand or a precursor in pharmaceutical applications. Its molecular interactions are influenced by the functional groups present, which can participate in hydrogen bonding and other intermolecular forces. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound's unique structure and properties make it of interest in various fields, including medicinal chemistry and drug development.
Formula:C7H12N4·ClH
InChI:InChI=1S/C7H12N4.ClH/c1-11(2)7-3-4-9-6(5-8)10-7;/h3-4H,5,8H2,1-2H3;1H
InChI key:InChIKey=MOKNSDAYMBQNPQ-UHFFFAOYSA-N
SMILES:N(C)(C)C1=NC(CN)=NC=C1.Cl
Synonyms:- 2-Pyrimidinemethanamine, 4-(dimethylamino)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.