CAS 1196146-34-5

1,1-Dimethylethyl 4-[2-(chlorosulfonyl)ethyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 4-[2-(chlorosulfonyl)ethyl]-1-piperazinecarboxylate is a chemical compound characterized by its complex structure, which includes a piperazine ring, a carboxylate group, and a chlorosulfonyl substituent. This compound is typically classified as an organic sulfonate and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the chlorosulfonyl group suggests reactivity that could be exploited in further chemical transformations or in the synthesis of more complex molecules. Additionally, the dimethyl substituents on the ethyl group contribute to steric hindrance, which may influence the compound's biological activity and interaction with target proteins. Its solubility and stability in various solvents can vary, making it important to consider these factors in practical applications. Overall, this compound exemplifies the intricate interplay of functional groups that can lead to diverse chemical behaviors and potential therapeutic uses.

Formula: C₁₁H₂₁ClN₂O₄S

InChI: InChI=1S/C11H21ClN2O4S/c1-11(2,3)18-10(15)14-6-4-13(5-7-14)8-9-19(12,16)17/h4-9H2,1-3H3

InChI key: InChIKey=ZZNPBIYJAMLKLV-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCN(CCS(Cl)(=O)=O)CC1

Synonyms:

• 1-Piperazinecarboxylic acid, 4-[2-(chlorosulfonyl)ethyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[2-(chlorosulfonyl)ethyl]-1-piperazinecarboxylate