
CAS 1196146-43-6
:1H-Pyrazole-1-ethanesulfonyl chloride
Description:
1H-Pyrazole-1-ethanesulfonyl chloride is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethanesulfonyl chloride functional group, making it a sulfonyl chloride derivative. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the sulfonyl chloride group indicates that it is reactive, particularly with nucleophiles, which makes it useful in various synthetic applications, including the preparation of sulfonamides and other derivatives. The compound is often handled with care due to its potential to release hydrochloric acid upon reaction and its reactivity towards moisture, which can lead to hydrolysis. In terms of solubility, it is generally soluble in organic solvents but may react with water. As with many sulfonyl chlorides, it is important to consider safety precautions when working with this compound, as it can be corrosive and irritating to skin and eyes.
Formula:C5H7ClN2O2S
InChI:InChI=1S/C5H7ClN2O2S/c6-11(9,10)5-4-8-3-1-2-7-8/h1-3H,4-5H2
InChI key:InChIKey=JCRIKDUKXMMPIU-UHFFFAOYSA-N
SMILES:C(CS(Cl)(=O)=O)N1C=CC=N1
Synonyms:- 1H-Pyrazole-1-ethanesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.