
CAS 1196146-45-8
:2-Chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine
Description:
2-Chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine is a heterocyclic organic compound characterized by its bicyclic structure, which includes a pyridine ring fused to a cyclopentane ring. The presence of a chlorine atom at the 2-position and an amino group at the 5-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, while its hydrophobic cyclopentane component may limit solubility in non-polar solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its unique arrangement of atoms may influence its interaction with biological targets, making it a candidate for further research in drug discovery. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C8H9ClN2
InChI:InChI=1S/C8H9ClN2/c9-8-4-1-5-6(10)2-3-7(5)11-8/h1,4,6H,2-3,10H2
InChI key:InChIKey=MCDGMURAYHDBDB-UHFFFAOYSA-N
SMILES:NC1C=2C(CC1)=NC(Cl)=CC2
Synonyms:- 5H-Cyclopenta[b]pyridin-5-amine, 2-chloro-6,7-dihydro-
- 2-Chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.