CAS 1196146-49-2

4-Ethynyl-3-methoxypyridine

Description:

4-Ethynyl-3-methoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an ethynyl group at the 4-position and a methoxy group at the 3-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, reflecting its non-polar characteristics due to the presence of the ethynyl group. The methoxy group enhances its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken during use. Overall, 4-Ethynyl-3-methoxypyridine is a valuable compound in synthetic organic chemistry with potential applications in various fields.

Formula: C₈H₇NO

InChI: InChI=1S/C8H7NO/c1-3-7-4-5-9-6-8(7)10-2/h1,4-6H,2H3

InChI key: InChIKey=AZGBYLUQCWWSFZ-UHFFFAOYSA-N

SMILES: C(#C)C=1C(OC)=CN=CC1

Synonyms:

• Pyridine, 4-ethynyl-3-methoxy-
• 4-Ethynyl-3-methoxypyridine