CymitQuimica logo

CAS 1196146-50-5

:

2,5-Dichloro-4-(chloromethyl)pyridine

Description:
2,5-Dichloro-4-(chloromethyl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features two chlorine atoms at the 2 and 5 positions of the pyridine ring, and a chloromethyl group (-CH2Cl) at the 4 position, contributing to its reactivity and potential applications in organic synthesis. The presence of multiple chlorine substituents enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. It is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The compound is of interest in the field of medicinal chemistry and agrochemicals due to its potential biological activity. Safety precautions should be observed when handling this substance, as it may pose health risks, including toxicity and environmental hazards. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C6H4Cl3N
InChI:InChI=1S/C6H4Cl3N/c7-2-4-1-6(9)10-3-5(4)8/h1,3H,2H2
InChI key:InChIKey=PFQJOEQCIPJRDS-UHFFFAOYSA-N
SMILES:C(Cl)C=1C(Cl)=CN=C(Cl)C1
Synonyms:
  • 2,5-Dichloro-4-(chloromethyl)pyridine
  • Pyridine, 2,5-dichloro-4-(chloromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.