CAS 1196147-05-3

2-Chloro-5-(1-methylethyl)pyrazine

Description:

2-Chloro-5-(1-methylethyl)pyrazine is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the second position and an isopropyl group at the fifth position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its potential applications in the field of flavor and fragrance chemistry, as well as in agrochemicals. The chlorine substituent can influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the isopropyl group can affect the compound's solubility and volatility. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 2-Chloro-5-(1-methylethyl)pyrazine exhibits characteristics typical of chlorinated heterocycles, with implications for both industrial and research applications.

Formula: C₇H₉ClN₂

InChI: InChI=1S/C7H9ClN2/c1-5(2)6-3-10-7(8)4-9-6/h3-5H,1-2H3

InChI key: InChIKey=XMZOJJZBMMEBQW-UHFFFAOYSA-N

SMILES: C(C)(C)C=1C=NC(Cl)=CN1

Synonyms:

• 2-Chloro-5-(1-methylethyl)pyrazine
• 2-Chloro-5-isopropylpyrazine
• Pyrazine, 2-chloro-5-(1-methylethyl)-