
CAS 1196147-24-6
:3,4,6,7-Tetrahydro-2-methyl-5H-benzimidazol-5-one
Description:
3,4,6,7-Tetrahydro-2-methyl-5H-benzimidazol-5-one is a heterocyclic organic compound characterized by its bicyclic structure, which includes a benzimidazole moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a methyl group at the 2-position of the benzimidazole. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as solubility in organic solvents and moderate stability under standard laboratory conditions. Its CAS number, 1196147-24-6, allows for precise identification in chemical databases. While specific physical properties like melting point, boiling point, and solubility can vary, compounds of this class often show interesting interactions with biological targets, which can be explored for pharmaceutical applications. Further studies would be necessary to elucidate its full chemical behavior and potential uses in various fields, including drug development and material science.
Formula:C8H10N2O
InChI:InChI=1S/C8H10N2O/c1-5-9-7-3-2-6(11)4-8(7)10-5/h2-4H2,1H3,(H,9,10)
InChI key:InChIKey=CJWGVSDXMKXEGY-UHFFFAOYSA-N
SMILES:CC=1NC2=C(N1)CC(=O)CC2
Synonyms:- 5H-Benzimidazol-5-one, 3,4,6,7-tetrahydro-2-methyl-
- 3,4,6,7-Tetrahydro-2-methyl-5H-benzimidazol-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.