CAS 1196147-26-8

Methyl 7,8-dihydro-1,6-naphthyridine-6(5H)-acetate

Description:

Methyl 7,8-dihydro-1,6-naphthyridine-6(5H)-acetate is a chemical compound characterized by its naphthyridine core, which is a bicyclic structure containing nitrogen atoms. This compound features an acetate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl group enhances its lipophilicity, which may influence its solubility in organic solvents. The dihydro configuration indicates that the compound has two hydrogen atoms added to the naphthyridine ring, affecting its electronic properties and stability. Typically, such compounds may exhibit biological activity, making them of interest in medicinal chemistry. The specific arrangement of atoms and functional groups can lead to unique interactions with biological targets, potentially resulting in pharmacological effects. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use. Overall, Methyl 7,8-dihydro-1,6-naphthyridine-6(5H)-acetate represents a class of compounds that may have significant implications in research and development within the fields of chemistry and pharmacology.

Formula: C₁₁H₁₄N₂O₂

InChI: InChI=1S/C11H14N2O2/c1-15-11(14)8-13-6-4-10-9(7-13)3-2-5-12-10/h2-3,5H,4,6-8H2,1H3

InChI key: InChIKey=DMJHRDQFWXOHEH-UHFFFAOYSA-N

SMILES: C(C(OC)=O)N1CC=2C(CC1)=NC=CC2

Synonyms:

• 1,6-Naphthyridine-6(5H)-acetic acid, 7,8-dihydro-, methyl ester
• Methyl 7,8-dihydro-1,6-naphthyridine-6(5H)-acetate