CAS 1196147-49-5

4-Bromo-6-(trifluoromethyl)-2-pyridinamine

Description:

4-Bromo-6-(trifluoromethyl)-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of a bromine atom at the 4-position and a trifluoromethyl group at the 6-position significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and influencing biological activity. As a pyridinamine, it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in pharmaceutical and agrochemical research. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.

Formula: C₆H₄BrF₃N₂

InChI: InChI=1S/C6H4BrF3N2/c7-3-1-4(6(8,9)10)12-5(11)2-3/h1-2H,(H2,11,12)

InChI key: InChIKey=HAHXGHOCCWZKAV-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(Br)=CC(N)=N1

Synonyms:

• 4-Bromo-6-(trifluoromethyl)-2-pyridinamine
• 2-Pyridinamine, 4-bromo-6-(trifluoromethyl)-