CAS 1196147-69-9
:3-[Bis(1-methylethyl)phosphino]-1-propanamine
Description:
3-[Bis(1-methylethyl)phosphino]-1-propanamine, with the CAS number 1196147-69-9, is a chemical compound characterized by the presence of a propanamine backbone substituted with two bis(1-methylethyl) phosphino groups. This structure imparts unique properties, making it a potential ligand in coordination chemistry, particularly in catalysis and organometallic chemistry. The phosphino groups enhance the electron-donating ability of the molecule, which can facilitate the formation of metal-ligand complexes. The presence of the amine functional group contributes to its basicity and potential reactivity, allowing for interactions with various metal centers. Additionally, the steric bulk provided by the isopropyl groups can influence the selectivity and reactivity of the complexes formed. Overall, this compound is of interest in synthetic chemistry and materials science due to its potential applications in catalysis and as a building block for more complex molecular architectures.
Formula:C9H22NP
InChI:InChI=1S/C9H22NP/c1-8(2)11(9(3)4)7-5-6-10/h8-9H,5-7,10H2,1-4H3
InChI key:InChIKey=RVKSUPMPCDJZRG-UHFFFAOYSA-N
SMILES:P(CCCN)(C(C)C)C(C)C
Synonyms:- (3-Aminopropyl)diisopropylphosphine
- 1-Propanamine, 3-[bis(1-methylethyl)phosphino]-
- (3-Aminopropyl)bis(propan-2-yl)phosphane
- 3-[Bis(1-methylethyl)phosphino]-1-propanamine
- 3-(Diisopropylphosphino)-1-propanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.