
CAS 1196151-15-1
:N,N-Diethyl-5-ethynyl-2-pyridinamine
Description:
N,N-Diethyl-5-ethynyl-2-pyridinamine is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with an amine group and at the 5-position with an ethynyl group. The presence of the diethyl groups enhances its lipophilicity, potentially affecting its solubility and biological activity. This compound may exhibit interesting properties due to the combination of the pyridine moiety and the ethynyl group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyridine derivatives are often associated with diverse biological activities. Additionally, the ethynyl group can facilitate further functionalization, making it a versatile intermediate in organic synthesis. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, N,N-Diethyl-5-ethynyl-2-pyridinamine represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C11H14N2
InChI:InChI=1S/C11H14N2/c1-4-10-7-8-11(12-9-10)13(5-2)6-3/h1,7-9H,5-6H2,2-3H3
InChI key:InChIKey=XPHPMFXSMCCRHO-UHFFFAOYSA-N
SMILES:N(CC)(CC)C1=CC=C(C#C)C=N1
Synonyms:- N,N-Diethyl-5-ethynyl-2-pyridinamine
- 2-Pyridinamine, N,N-diethyl-5-ethynyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.