CymitQuimica logo

CAS 1196151-17-3

:

4-Chloro-2,6-dimethyl-5-pyrimidinecarbonitrile

Description:
4-Chloro-2,6-dimethyl-5-pyrimidinecarbonitrile is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains nitrogen atoms in the aromatic system. The presence of a chloro group at the 4-position and two methyl groups at the 2 and 6 positions contributes to its unique chemical properties. The carbonitrile functional group at the 5-position enhances its reactivity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential for various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, the presence of halogen and cyano groups can influence its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Chloro-2,6-dimethyl-5-pyrimidinecarbonitrile is a significant compound in synthetic organic chemistry with diverse applications.
Formula:C7H6ClN3
InChI:InChI=1S/C7H6ClN3/c1-4-6(3-9)7(8)11-5(2)10-4/h1-2H3
InChI key:InChIKey=LNXQVYJSIURADC-UHFFFAOYSA-N
SMILES:C(#N)C=1C(C)=NC(C)=NC1Cl
Synonyms:
  • 4-Chloro-2,6-dimethyl-5-pyrimidinecarbonitrile
  • 5-Pyrimidinecarbonitrile, 4-chloro-2,6-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.