CAS 1196151-32-2

5-Chloro-2-pyrazineacetic acid

Description:

5-Chloro-2-pyrazineacetic acid is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chloro substituent at the 5-position and a carboxylic acid group at the 2-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and is soluble in polar solvents due to the carboxylic acid functionality. It may exhibit acidic behavior, allowing it to participate in various chemical reactions, such as esterification or amidation. The chloro group can also serve as a site for further substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, compounds with similar structures are often studied for their potential biological activities, including antimicrobial or anti-inflammatory properties. As with many chemical substances, safety precautions should be observed when handling 5-Chloro-2-pyrazineacetic acid, as it may pose health risks if ingested or inhaled.

Formula: C₆H₅ClN₂O₂

InChI: InChI=1S/C6H5ClN2O2/c7-5-3-8-4(2-9-5)1-6(10)11/h2-3H,1H2,(H,10,11)

InChI key: InChIKey=MCEZQJUURIJSNU-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C=NC(Cl)=CN1

Synonyms:

• 5-Chloro-2-pyrazineacetic acid
• 2-(5-Chloropyrazin-2-yl)acetic acid
• 2-Pyrazineacetic acid, 5-chloro-

5-Chloro-2-Pyrazineacetic Acid

Controlled Product

CAS: 1196151-32-2

Formula: C₆H₅ClN₂O₂

Color and Shape: Neat

Molecular weight: 172.569

Ref: TR-C379235