
CAS 1196151-33-3
:5-(Trifluoromethyl)-2-pyrazineacetic acid
Description:
5-(Trifluoromethyl)-2-pyrazineacetic acid is a chemical compound characterized by its unique structure, which includes a pyrazine ring and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, contributing to its potential reactivity and solubility in various solvents. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The carboxylic acid functional group in the molecule allows for hydrogen bonding and can participate in acid-base reactions. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the trifluoromethyl group, which can affect its reactivity in chemical synthesis. Overall, 5-(Trifluoromethyl)-2-pyrazineacetic acid is a versatile compound with potential applications in pharmaceuticals and agrochemicals, warranting further investigation into its chemical behavior and biological effects.
Formula:C7H5F3N2O2
InChI:InChI=1S/C7H5F3N2O2/c8-7(9,10)5-3-11-4(2-12-5)1-6(13)14/h2-3H,1H2,(H,13,14)
InChI key:InChIKey=FLRAWHNSRCJYSG-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=NC(CC(O)=O)=CN1
Synonyms:- 2-Pyrazineacetic acid, 5-(trifluoromethyl)-
- 5-(Trifluoromethyl)-2-pyrazineacetic acid
- 2-[5-(Trifluoromethyl)pyrazin-2-yl]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.