CAS 1196151-34-4

7-Amino-2(3H)-benzothiazolethione

Description:

7-Amino-2(3H)-benzothiazolethione is a chemical compound characterized by its unique structure, which includes a benzothiazole ring fused with a thiol group and an amino group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the amino and thiol functional groups. It may display solubility in polar solvents, and its reactivity can be influenced by the electron-donating and electron-withdrawing characteristics of the substituents on the benzothiazole ring. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a scaffold for drug development or as a reagent in synthetic chemistry. Additionally, its potential applications could extend to areas such as agrochemicals or materials science, depending on its specific properties and reactivity. As with many chemical substances, safety data and handling precautions should be reviewed before use, given the potential for toxicity or reactivity associated with thiol-containing compounds.

Formula: C₇H₆N₂S₂

InChI: InChI=1S/C7H6N2S2/c8-4-2-1-3-5-6(4)11-7(10)9-5/h1-3H,8H2,(H,9,10)

InChI key: InChIKey=WUZZDDHBFBVBMF-UHFFFAOYSA-N

SMILES: NC1=C2C(NC(=S)S2)=CC=C1

Synonyms:

• 7-Amino-2(3H)-benzothiazolethione
• 2(3H)-Benzothiazolethione, 7-amino-