
CAS 1196151-37-7
:5-Methyl-2-pyrazineethanesulfonyl chloride
Description:
5-Methyl-2-pyrazineethanesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a pyrazine ring, a bicyclic structure that contributes to its aromatic properties and potential biological activity. The presence of the methyl group at the 5-position of the pyrazine ring influences its steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. As a sulfonyl chloride, it is typically used as a reagent in organic synthesis, particularly for the introduction of sulfonamide groups into various substrates. The compound is likely to be a solid at room temperature and may exhibit moderate to high solubility in polar organic solvents. Due to the presence of the sulfonyl chloride moiety, it can be corrosive and should be handled with care, using appropriate safety measures to avoid exposure. Its applications may extend to pharmaceuticals, agrochemicals, and materials science, depending on its reactivity and functionalization potential.
Formula:C7H9ClN2O2S
InChI:InChI=1S/C7H9ClN2O2S/c1-6-4-10-7(5-9-6)2-3-13(8,11)12/h4-5H,2-3H2,1H3
InChI key:InChIKey=YZDFMAHRTXEQFW-UHFFFAOYSA-N
SMILES:C(CS(Cl)(=O)=O)C=1C=NC(C)=CN1
Synonyms:- 5-Methyl-2-pyrazineethanesulfonyl chloride
- 2-Pyrazineethanesulfonyl chloride, 5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.