
CAS 1196151-42-4
:5-Chloro-2-pyrazinepropanamine
Description:
5-Chloro-2-pyrazinepropanamine is a chemical compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 5-position of the pyrazine ring contributes to its reactivity and potential applications in various chemical reactions. The propanamine side chain indicates that the compound has an amine functional group, which can participate in hydrogen bonding and nucleophilic reactions. This compound may exhibit properties typical of both aromatic and aliphatic amines, such as basicity and the ability to form salts. Its structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the presence of chlorine may influence its biological activity and solubility. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the specific characteristics can vary based on purity and environmental conditions.
Formula:C7H10ClN3
InChI:InChI=1S/C7H10ClN3/c8-7-5-10-6(4-11-7)2-1-3-9/h4-5H,1-3,9H2
InChI key:InChIKey=KAZNSMSOUAODEH-UHFFFAOYSA-N
SMILES:C(CCN)C=1C=NC(Cl)=CN1
Synonyms:- 2-Pyrazinepropanamine, 5-chloro-
- 5-Chloro-2-pyrazinepropanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.