CAS 1196151-47-9

6-Chloro-2-pyrazineethanamine

Description:

6-Chloro-2-pyrazineethanamine, identified by its CAS number 1196151-47-9, is a chemical compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The compound features a chloro substituent at the 6-position of the pyrazine ring and an ethanamine group attached at the 2-position. This structure imparts specific chemical properties, including potential reactivity due to the presence of the amino group, which can participate in various chemical reactions such as nucleophilic substitutions. The chloro group may also influence the compound's reactivity and solubility in different solvents. 6-Chloro-2-pyrazineethanamine may be of interest in medicinal chemistry and drug development due to its potential biological activity, particularly in the context of targeting specific receptors or enzymes. As with many nitrogen-containing heterocycles, it may exhibit unique pharmacological properties, making it a subject of study in various chemical and biological research fields.

Formula: C₆H₈ClN₃

InChI: InChI=1S/C6H8ClN3/c7-6-4-9-3-5(10-6)1-2-8/h3-4H,1-2,8H2

InChI key: InChIKey=FRYUUJOBQGTPBK-UHFFFAOYSA-N

SMILES: C(CN)C1=NC(Cl)=CN=C1

Synonyms:

• 6-Chloro-2-pyrazineethanamine
• 2-Pyrazineethanamine, 6-chloro-