CAS 1196151-48-0

Piperidine, 4-(4-nitrophenyl)-, sulfate (1:1)

Description:

Piperidine, 4-(4-nitrophenyl)-, sulfate (1:1) is a chemical compound characterized by its piperidine ring structure substituted with a 4-nitrophenyl group. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the sulfate moiety. The nitrophenyl group contributes to its potential as a chromophore, making it useful in various applications, including organic synthesis and as a reagent in chemical reactions. The sulfate group enhances its solubility and reactivity, allowing it to participate in nucleophilic substitution reactions. Additionally, the presence of the nitro group may impart specific electronic properties, influencing the compound's reactivity and interaction with biological systems. Safety data should be consulted, as nitro compounds can exhibit toxicity and environmental hazards. Overall, this compound is of interest in both academic research and industrial applications, particularly in the fields of medicinal chemistry and materials science.

Formula: C₁₁H₁₄N₂O₂·H₂O₄S

InChI: InChI=1S/C11H14N2O2.H2O4S/c14-13(15)11-3-1-9(2-4-11)10-5-7-12-8-6-10;1-5(2,3)4/h1-4,10,12H,5-8H2;(H2,1,2,3,4)

InChI key: InChIKey=PKSYUXKSHPDVJW-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CC=C(C=C1)C2CCNCC2.S(=O)(=O)(O)O

Synonyms:

• 4-(4-Nitrophenyl)piperidine hydrogen sulfate
• Piperidine, 4-(4-nitrophenyl)-, sulfate (1:1)