CAS 1196151-52-6

1,1-Dimethylethyl 4-[(chlorosulfonyl)methyl]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[(chlorosulfonyl)methyl]-1-piperidinecarboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring, a carboxylate group, and a chlorosulfonyl substituent. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It exhibits moderate to high polarity due to the presence of the sulfonyl and carboxylate functional groups, which can influence its solubility in various solvents. The chlorosulfonyl group is particularly reactive, making this compound useful in synthetic organic chemistry, especially in the development of pharmaceuticals and agrochemicals. Its reactivity can facilitate nucleophilic substitution reactions, allowing for further functionalization. Safety data indicates that it should be handled with care, as it may pose hazards such as skin and respiratory irritation. Proper storage conditions are essential to maintain its stability and prevent degradation. Overall, this compound serves as an important intermediate in chemical synthesis, with potential applications in various fields.

Formula: C₁₁H₂₀ClNO₄S

InChI: InChI=1S/C11H20ClNO4S/c1-11(2,3)17-10(14)13-6-4-9(5-7-13)8-18(12,15)16/h9H,4-8H2,1-3H3

InChI key: InChIKey=AYOXDBOOFYZYJD-UHFFFAOYSA-N

SMILES: C(S(Cl)(=O)=O)C1CCN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[(chlorosulfonyl)methyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[(chlorosulfonyl)methyl]-1-piperidinecarboxylate