CAS 1196151-68-4

3-(Chloromethyl)-7,8-dihydro-5H-pyrano[4,3-b]pyridine

Description:

3-(Chloromethyl)-7,8-dihydro-5H-pyrano[4,3-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyridine and a pyran ring. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of the dihydro configuration indicates that the compound has two hydrogen atoms added to the pyridine ring, contributing to its stability and influencing its chemical behavior. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyridine derivatives. Additionally, the chloromethyl group can serve as a useful functional handle for further synthetic transformations, making it a valuable intermediate in organic synthesis. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks or environmental hazards.

Formula: C₉H₁₀ClNO

InChI: InChI=1S/C9H10ClNO/c10-4-7-3-8-6-12-2-1-9(8)11-5-7/h3,5H,1-2,4,6H2

InChI key: InChIKey=YFQRMFOZRUTBFV-UHFFFAOYSA-N

SMILES: C(Cl)C=1C=C2C(=NC1)CCOC2

Synonyms:

• 3-(Chloromethyl)-7,8-dihydro-5H-pyrano[4,3-b]pyridine
• 5H-Pyrano[4,3-b]pyridine, 3-(chloromethyl)-7,8-dihydro-