
CAS 1196151-71-9
:3-(Chloromethyl)-4-methoxypyridine
Description:
3-(Chloromethyl)-4-methoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloromethyl group at the 3-position and a methoxy group at the 4-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it useful in various chemical reactions, particularly in the synthesis of more complex molecules. The chloromethyl group can serve as a reactive site for nucleophilic substitution reactions, while the methoxy group can influence the electronic properties of the molecule, affecting its reactivity and interactions with other substances. Due to its structural features, 3-(Chloromethyl)-4-methoxypyridine may find applications in pharmaceuticals, agrochemicals, and materials science, although specific uses would depend on further research and development. Safety precautions should be observed when handling this compound, as it may pose health risks.
Formula:C7H8ClNO
InChI:InChI=1S/C7H8ClNO/c1-10-7-2-3-9-5-6(7)4-8/h2-3,5H,4H2,1H3
InChI key:InChIKey=DVLWRRDACHRIHS-UHFFFAOYSA-N
SMILES:C(Cl)C=1C(OC)=CC=NC1
Synonyms:- Pyridine, 3-(chloromethyl)-4-methoxy-
- 3-(Chloromethyl)-4-methoxypyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.