
CAS 1196151-75-3
:6,7-Dihydro-3-(trifluoromethyl)-5H-cyclopenta[b]pyridin-5-amine
Description:
6,7-Dihydro-3-(trifluoromethyl)-5H-cyclopenta[b]pyridin-5-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a cyclopentane fused to a pyridine ring. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The presence of the amino group contributes to its basicity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions and applications in medicinal chemistry. The compound's structure suggests potential interactions with biological targets, which may be explored in drug development. Additionally, the trifluoromethyl group can enhance metabolic stability and alter pharmacokinetic properties. Overall, 6,7-Dihydro-3-(trifluoromethyl)-5H-cyclopenta[b]pyridin-5-amine is of interest in research for its potential therapeutic applications and unique chemical characteristics.
Formula:C9H9F3N2
InChI:InChI=1S/C9H9F3N2/c10-9(11,12)5-3-6-7(13)1-2-8(6)14-4-5/h3-4,7H,1-2,13H2
InChI key:InChIKey=QGWPRRAQSVVDOI-UHFFFAOYSA-N
SMILES:NC1C=2C(=NC=C(C(F)(F)F)C2)CC1
Synonyms:- 6,7-Dihydro-3-(trifluoromethyl)-5H-cyclopenta[b]pyridin-5-amine
- 5H-Cyclopenta[b]pyridin-5-amine, 6,7-dihydro-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.