CAS 1196151-81-1

4-Methyl-2-oxazolecarboxylic acid

Description:

4-Methyl-2-oxazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of both an oxazole ring and a carboxylic acid functional group. The oxazole ring consists of a five-membered aromatic structure containing both nitrogen and oxygen atoms, which contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. Its molecular structure allows for potential reactivity in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the methyl group at the 4-position can influence the compound's steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. 4-Methyl-2-oxazolecarboxylic acid may find applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific applications would depend on further research and development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₅H₅NO₃

InChI: InChI=1S/C5H5NO3/c1-3-2-9-4(6-3)5(7)8/h2H,1H3,(H,7,8)

InChI key: InChIKey=DQNBHCVJLBBYRW-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NC(C)=CO1

Synonyms:

• 4-Methyl-2-oxazolecarboxylic acid
• 2-Oxazolecarboxylic acid, 4-methyl-

4-Methyloxazole-2-carboxylic acid

CAS: 1196151-81-1

Formula: C₅H₅NO₃

Molecular weight: 127.0981

Ref: IN-DA000PBO

4-Methyloxazole-2-carboxylic Acid

Controlled Product

CAS: 1196151-81-1

Applications 4-Methyloxazole-2-carboxylic Acid is an oxazole compound thus carrying the potential to display biological activity in vitro.
References Dondoni, A. et al.: J. Org. Chem., 52, 3413 (1987);

Formula: C₅H₅NO₃

Color and Shape: Neat

Molecular weight: 127.098

Ref: TR-M325530