CAS 1196151-81-1
:4-Methyl-2-oxazolecarboxylic acid
Description:
4-Methyl-2-oxazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of both an oxazole ring and a carboxylic acid functional group. The oxazole ring consists of a five-membered aromatic structure containing both nitrogen and oxygen atoms, which contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. Its molecular structure allows for potential reactivity in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the methyl group at the 4-position can influence the compound's steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. 4-Methyl-2-oxazolecarboxylic acid may find applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific applications would depend on further research and development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C5H5NO3
InChI:InChI=1S/C5H5NO3/c1-3-2-9-4(6-3)5(7)8/h2H,1H3,(H,7,8)
InChI key:InChIKey=DQNBHCVJLBBYRW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=NC(C)=CO1
Synonyms:- 4-Methyl-2-oxazolecarboxylic acid
- 2-Oxazolecarboxylic acid, 4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Methyloxazole-2-carboxylic Acid
CAS:Controlled ProductApplications 4-Methyloxazole-2-carboxylic Acid is an oxazole compound thus carrying the potential to display biological activity in vitro.
References Dondoni, A. et al.: J. Org. Chem., 52, 3413 (1987);Formula:C5H5NO3Color and Shape:NeatMolecular weight:127.098

