CymitQuimica logo

CAS 1196151-85-5

:

6-Chloro-1,2,3,4-tetrahydro-2,7-naphthyridine

Description:
6-Chloro-1,2,3,4-tetrahydro-2,7-naphthyridine is a heterocyclic organic compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features a chlorine atom at the 6-position and a saturated tetrahydro framework, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the tetrahydro configuration may impart specific stereochemical characteristics that can affect its biological activity. Compounds of this type are often investigated for their potential pharmacological applications, particularly in the development of pharmaceuticals targeting various biological pathways. As with many heterocycles, the electronic properties and steric factors associated with the chlorine and nitrogen atoms can play a significant role in the compound's interactions with biological systems. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C8H9ClN2
InChI:InChI=1S/C8H9ClN2/c9-8-3-6-1-2-10-4-7(6)5-11-8/h3,5,10H,1-2,4H2
InChI key:InChIKey=ILZWVKZOOVYENC-UHFFFAOYSA-N
SMILES:ClC=1C=C2C(=CN1)CNCC2
Synonyms:
  • 2,7-Naphthyridine, 6-chloro-1,2,3,4-tetrahydro-
  • 6-Chloro-1,2,3,4-tetrahydro-2,7-naphthyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.