CymitQuimica logo

CAS 1196151-86-6

:

3-(Methylsulfonyl)benzenepropanamine

Description:
3-(Methylsulfonyl)benzenepropanamine, also known by its CAS number 1196151-86-6, is an organic compound characterized by the presence of a benzene ring substituted with a methylsulfonyl group and a propanamine chain. This compound features a sulfonyl functional group, which contributes to its polar nature and potential for hydrogen bonding, influencing its solubility and reactivity. The presence of the amine group suggests that it may exhibit basic properties and can participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the methylsulfonyl group can enhance the compound's stability and may affect its biological activity, making it of interest in pharmaceutical research. The compound's molecular structure indicates potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Overall, 3-(Methylsulfonyl)benzenepropanamine is a compound of interest due to its unique functional groups and potential utility in various chemical and biological contexts.
Formula:C10H15NO2S
InChI:InChI=1S/C10H15NO2S/c1-14(12,13)10-6-2-4-9(8-10)5-3-7-11/h2,4,6,8H,3,5,7,11H2,1H3
InChI key:InChIKey=WLZQPVXERBHYRY-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=CC(CCCN)=CC=C1
Synonyms:
  • 3-(Methylsulfonyl)benzenepropanamine
  • Benzenepropanamine, 3-(methylsulfonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.