
CAS 1196151-90-2
:3-(2-Amino-2-methylpropyl)phenol
Description:
3-(2-Amino-2-methylpropyl)phenol, identified by its CAS number 1196151-90-2, is an organic compound characterized by the presence of a phenolic group and an aminoalkyl side chain. This compound features a phenol ring substituted at the 3-position with a 2-amino-2-methylpropyl group, which contributes to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of both hydrophobic (phenyl) and hydrophilic (amino and hydroxyl) functional groups. The amino group can participate in hydrogen bonding, enhancing its reactivity and potential applications in various chemical reactions, including as a building block in organic synthesis or as a ligand in coordination chemistry. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c1-10(2,11)7-8-4-3-5-9(12)6-8/h3-6,12H,7,11H2,1-2H3
InChI key:InChIKey=KVWMVUFXHWKGST-UHFFFAOYSA-N
SMILES:C(C(C)(C)N)C1=CC(O)=CC=C1
Synonyms:- Phenol, 3-(2-amino-2-methylpropyl)-
- 3-(2-Amino-2-methylpropyl)phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.