CAS 1196151-91-3

Methyl 4-ethynyl-2-pyridinecarboxylate

Description:

Methyl 4-ethynyl-2-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an ethynyl group, which is a terminal alkyne, contributing to its reactivity and potential applications in organic synthesis. The presence of the carboxylate functional group indicates that it can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Methyl 4-ethynyl-2-pyridinecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, making it useful in various chemical processes. The compound may exhibit biological activity, and its derivatives are often explored in medicinal chemistry for potential therapeutic applications. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, its unique structure and functional groups make it a valuable compound in synthetic organic chemistry.

Formula: C₉H₇NO₂

InChI: InChI=1S/C9H7NO2/c1-3-7-4-5-10-8(6-7)9(11)12-2/h1,4-6H,2H3

InChI key: InChIKey=DUFAATULZHETGT-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC(C#C)=CC=N1

Synonyms:

• Methyl 4-ethynyl-2-pyridinecarboxylate
• 2-Pyridinecarboxylic acid, 4-ethynyl-, methyl ester

Methyl 4-ethynylpyridine-2-carboxylate

CAS: 1196151-91-3

Methyl 4-ethynylpyridine-2-carboxylate

Purity: 96%

Molecular weight: 161.16g/mol

Ref: 54-OR88620

Methyl 4-ethynylpyridine-2-carboxylate

CAS: 1196151-91-3

Purity: 96%

Molecular weight: 161.1600037

Ref: 10-F652274