CAS 1196151-93-5

5-Ethynyl-2-(1-pyrrolidinyl)pyridine

Description:

5-Ethynyl-2-(1-pyrrolidinyl)pyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with an ethynyl group and a pyrrolidine moiety. This compound typically exhibits properties associated with both heterocyclic compounds and alkynes, such as potential reactivity in various organic synthesis reactions. The presence of the ethynyl group can enhance its ability to participate in coupling reactions, while the pyrrolidine ring may contribute to its solubility and interaction with biological systems. The compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the pyridine and pyrrolidine structures can lead to variations in biological activity. Additionally, its molecular structure suggests that it may exhibit specific electronic properties, which could influence its behavior in chemical reactions and interactions with other molecules. As with many organic compounds, safety and handling precautions should be observed, given the potential for reactivity and toxicity associated with certain functional groups.

Formula: C₁₁H₁₂N₂

InChI: InChI=1S/C11H12N2/c1-2-10-5-6-11(12-9-10)13-7-3-4-8-13/h1,5-6,9H,3-4,7-8H2

InChI key: InChIKey=QCWQXLKLNMKUOL-UHFFFAOYSA-N

SMILES: C(#C)C1=CC=C(N=C1)N2CCCC2

Synonyms:

• 5-Ethynyl-2-(1-pyrrolidinyl)pyridine
• Pyridine, 5-ethynyl-2-(1-pyrrolidinyl)-