
CAS 1196152-01-8
:4,5-Dichloro-2-(chloromethyl)pyridine
Description:
4,5-Dichloro-2-(chloromethyl)pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two chlorine atoms at the 4 and 5 positions and a chloromethyl group at the 2 position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its reactivity due to the presence of multiple halogen substituents, which can participate in various chemical reactions, including nucleophilic substitutions. The chloromethyl group enhances its electrophilic character, making it a useful intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, although specific biological properties would depend on the context of its use. Safety precautions should be taken when handling this substance, as it may pose health risks due to its chlorinated nature. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety in laboratory settings.
Formula:C6H4Cl3N
InChI:InChI=1S/C6H4Cl3N/c7-2-4-1-5(8)6(9)3-10-4/h1,3H,2H2
InChI key:InChIKey=QUAHYVNBPSFMCD-UHFFFAOYSA-N
SMILES:C(Cl)C1=CC(Cl)=C(Cl)C=N1
Synonyms:- 4,5-Dichloro-2-(chloromethyl)pyridine
- Pyridine, 4,5-dichloro-2-(chloromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.