CymitQuimica logo

CAS 1196152-19-8

:

4(3H)-Pyrimidinone, 2-(aminomethyl)-, hydrochloride (1:1)

Description:
4(3H)-Pyrimidinone, 2-(aminomethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidinone core structure, which features a six-membered aromatic ring containing nitrogen atoms. This compound typically exhibits properties associated with both amines and pyrimidines, including potential basicity due to the presence of the amino group. As a hydrochloride salt, it is soluble in water, which enhances its bioavailability and makes it suitable for various applications, particularly in pharmaceutical contexts. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with biological molecules. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of drugs targeting various biological pathways. The compound's CAS number, 1196152-19-8, serves as a unique identifier, facilitating its recognition in chemical databases and literature. Overall, this substance is of interest for its potential therapeutic properties and its role in chemical synthesis.
Formula:C5H7N3O·ClH
InChI:InChI=1S/C5H7N3O.ClH/c6-3-4-7-2-1-5(9)8-4;/h1-2H,3,6H2,(H,7,8,9);1H
InChI key:InChIKey=IZHZXHQYKVTSQO-UHFFFAOYSA-N
SMILES:C(N)C=1NC(=O)C=CN1.Cl
Synonyms:
  • 4(3H)-Pyrimidinone, 2-(aminomethyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.