CymitQuimica logo

CAS 1196152-25-6

:

5-Methoxy-1-isoquinolinamine

Description:
5-Methoxy-1-isoquinolinamine is a chemical compound characterized by its isoquinoline structure, which features a fused bicyclic system containing a nitrogen atom. This compound is notable for the presence of a methoxy group (-OCH3) at the 5-position of the isoquinoline ring, which can influence its solubility and reactivity. The amine functional group (-NH2) at the 1-position contributes to its potential as a biological active molecule, possibly exhibiting pharmacological properties. The presence of both the methoxy and amine groups may enhance its ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which could affect its behavior in various chemical environments. As with many isoquinoline derivatives, it may also exhibit fluorescence properties, making it useful in certain analytical applications. Overall, 5-Methoxy-1-isoquinolinamine represents a compound with diverse potential applications in research and development within the fields of chemistry and pharmacology.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-13-9-4-2-3-8-7(9)5-6-12-10(8)11/h2-6H,1H3,(H2,11,12)
InChI key:InChIKey=AIRVMTOKPDSRBB-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C(N)=NC=C2)C=CC1
Synonyms:
  • 5-Methoxy-1-isoquinolinamine
  • 1-Isoquinolinamine, 5-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.