
CAS 1196152-26-7
:7-Hydroxy-2-methylthieno[3,2-b]pyridin-5(4H)-one
Description:
7-Hydroxy-2-methylthieno[3,2-b]pyridin-5(4H)-one is a heterocyclic compound characterized by its unique fused ring structure, which includes both thieno and pyridine moieties. This compound features a hydroxyl group at the 7-position and a methyl group at the 2-position, contributing to its chemical reactivity and potential biological activity. The presence of the thieno ring enhances its electron-rich character, which may influence its interactions in biological systems. It is typically studied for its potential pharmacological properties, including antimicrobial and anti-inflammatory activities. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As a synthetic or naturally occurring compound, it may be of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further research is often necessary to fully elucidate its properties and potential applications in various fields.
Formula:C8H7NO2S
InChI:InChI=1S/C8H7NO2S/c1-4-2-5-8(12-4)6(10)3-7(11)9-5/h2-3H,1H3,(H2,9,10,11)
InChI key:InChIKey=UBDVSPYLFWSUAC-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(C)S2)NC(=O)C1
Synonyms:- Thieno[3,2-b]pyridin-5(4H)-one, 7-hydroxy-2-methyl-
- 7-Hydroxy-2-methylthieno[3,2-b]pyridin-5(4H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.