CAS 1196152-35-8
:2-Furancarboxylic acid, 3-amino-, ethyl ester
Description:
2-Furancarboxylic acid, 3-amino-, ethyl ester, also known as ethyl 3-amino-2-furancarboxylate, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a carboxylic acid functional group and an amino group, contributing to its reactivity and potential applications in organic synthesis. The ethyl ester moiety enhances its solubility in organic solvents, making it useful in various chemical reactions. Typically, compounds like this exhibit moderate polarity due to the presence of both polar (carboxylic acid and amino) and non-polar (furan ring) components. The amino group can participate in hydrogen bonding, influencing its physical properties such as boiling and melting points. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structure allows for potential applications in the development of agrochemicals, pharmaceuticals, and as intermediates in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C7H9NO3
InChI:InChI=1S/C7H9NO3/c1-2-10-7(9)6-5(8)3-4-11-6/h3-4H,2,8H2,1H3
InChI key:InChIKey=HXELJVYXYWJKFL-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(N)C=CO1
Synonyms:- 2-Furancarboxylic acid, 3-amino-, ethyl ester
- Ethyl 3-Aminofuran-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
