CAS 1196152-42-7

1,6-Dihydro-4-methyl-6-oxo-2-pyridinecarbonitrile

Description:

1,6-Dihydro-4-methyl-6-oxo-2-pyridinecarbonitrile is a heterocyclic organic compound characterized by its pyridine ring structure, which incorporates both a carbonitrile and a ketone functional group. The presence of the carbonitrile group (-C≡N) contributes to its potential reactivity and applications in organic synthesis. The compound features a methyl group at the 4-position and a carbonyl group at the 6-position of the pyridine ring, which influences its chemical properties, including polarity and solubility. Typically, compounds of this nature exhibit moderate to high stability under standard conditions, but their reactivity can vary based on the presence of functional groups. This substance may be of interest in medicinal chemistry and material science due to its structural features, which can facilitate interactions with biological targets or serve as intermediates in the synthesis of more complex molecules. As with many nitrogen-containing heterocycles, it may also exhibit unique electronic properties that could be exploited in various applications.

Formula: C₇H₆N₂O

InChI: InChI=1S/C7H6N2O/c1-5-2-6(4-8)9-7(10)3-5/h2-3H,1H3,(H,9,10)

InChI key: InChIKey=DUOAVMHYZQBLOP-UHFFFAOYSA-N

SMILES: C(#N)C1=CC(C)=CC(=O)N1

Synonyms:

• 2-Pyridinecarbonitrile, 1,6-dihydro-4-methyl-6-oxo-
• 1,6-Dihydro-4-methyl-6-oxo-2-pyridinecarbonitrile