
CAS 1196152-52-9
:5-Methyl-2-pyrazinepropanamine
Description:
5-Methyl-2-pyrazinepropanamine, identified by its CAS number 1196152-52-9, is an organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a propanamine side chain, contributing to its amine functional group, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The methyl group at the 5-position of the pyrazine ring influences its reactivity and solubility properties. Generally, compounds like 5-Methyl-2-pyrazinepropanamine may exhibit biological activity, making them of interest in pharmaceutical and agrochemical research. The presence of both nitrogen atoms in the pyrazine ring and the amine group can also affect the compound's polarity and potential interactions with biological targets. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular structure and intermolecular forces present.
Formula:C8H13N3
InChI:InChI=1S/C8H13N3/c1-7-5-11-8(6-10-7)3-2-4-9/h5-6H,2-4,9H2,1H3
InChI key:InChIKey=QJXGUDOLECBKCU-UHFFFAOYSA-N
SMILES:C(CCN)C=1C=NC(C)=CN1
Synonyms:- 5-Methyl-2-pyrazinepropanamine
- 2-Pyrazinepropanamine, 5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.