
CAS 1196152-69-8
:5-(Phenylmethoxy)-1H-indazole-3-carbonitrile
Description:
5-(Phenylmethoxy)-1H-indazole-3-carbonitrile is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a phenylmethoxy group enhances its lipophilicity and may influence its biological activity. The carbonitrile functional group introduces a polar character, which can affect solubility and reactivity. This compound is typically used in medicinal chemistry and drug development due to its potential pharmacological properties. Its structure suggests that it may interact with various biological targets, making it of interest in the study of therapeutic agents. The compound's stability, reactivity, and interactions with other molecules can be influenced by factors such as pH, temperature, and solvent conditions. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation. Overall, 5-(Phenylmethoxy)-1H-indazole-3-carbonitrile represents a class of compounds that may have significant implications in pharmaceutical research.
Formula:C15H11N3O
InChI:InChI=1S/C15H11N3O/c16-9-15-13-8-12(6-7-14(13)17-18-15)19-10-11-4-2-1-3-5-11/h1-8H,10H2,(H,17,18)
InChI key:InChIKey=DEEHTLLABBRXBG-UHFFFAOYSA-N
SMILES:C(#N)C=1C=2C(NN1)=CC=C(OCC3=CC=CC=C3)C2
Synonyms:- 5-(Phenylmethoxy)-1H-indazole-3-carbonitrile
- 1H-Indazole-3-carbonitrile, 5-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.