CymitQuimica logo

CAS 1196152-82-5

:

6-Bromo-2-pyridinemethanesulfonyl chloride

Description:
6-Bromo-2-pyridinemethanesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a pyridine ring, which contributes to its aromatic properties and potential for various chemical interactions. The presence of the bromine atom at the 6-position of the pyridine ring enhances its electrophilic character, making it a useful intermediate in the synthesis of more complex molecules. The sulfonyl chloride group is particularly reactive, allowing for the introduction of sulfonamide functionalities in subsequent reactions. This compound is typically used in the preparation of pharmaceuticals, agrochemicals, and other fine chemicals, where it can participate in nucleophilic substitution reactions. Due to the presence of chlorine, it may also exhibit some level of toxicity and should be handled with appropriate safety precautions in a controlled laboratory environment. Overall, 6-Bromo-2-pyridinemethanesulfonyl chloride is a versatile reagent in synthetic organic chemistry.
Formula:C6H5BrClNO2S
InChI:InChI=1S/C6H5BrClNO2S/c7-6-3-1-2-5(9-6)4-12(8,10)11/h1-3H,4H2
InChI key:InChIKey=XICLZWXIQFNVRH-UHFFFAOYSA-N
SMILES:C(S(Cl)(=O)=O)C=1N=C(Br)C=CC1
Synonyms:
  • 6-Bromo-2-pyridinemethanesulfonyl chloride
  • 2-Pyridinemethanesulfonyl chloride, 6-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.