CymitQuimica logo

CAS 1196152-84-7

:

N-(5-Amino-3-methyl-2-pyridinyl)acetamide

Description:
N-(5-Amino-3-methyl-2-pyridinyl)acetamide, identified by its CAS number 1196152-84-7, is a chemical compound characterized by its pyridine ring structure, which contributes to its unique properties. This compound features an amino group and an acetamide functional group, indicating potential for hydrogen bonding and reactivity in various chemical environments. The presence of the methyl group on the pyridine ring enhances its lipophilicity, which may influence its solubility and biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The molecular structure suggests that it may exhibit both polar and non-polar characteristics, making it versatile in various chemical reactions. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are essential considerations in both laboratory and industrial settings. Overall, N-(5-Amino-3-methyl-2-pyridinyl)acetamide represents a class of compounds with significant potential in medicinal chemistry and related fields.
Formula:C8H11N3O
InChI:InChI=1S/C8H11N3O/c1-5-3-7(9)4-10-8(5)11-6(2)12/h3-4H,9H2,1-2H3,(H,10,11,12)
InChI key:InChIKey=YMRUAVDWBYTGNE-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(C)C=C(N)C=N1
Synonyms:
  • N-(5-Amino-3-methyl-2-pyridinyl)acetamide
  • Acetamide, N-(5-amino-3-methyl-2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.