CymitQuimica logo

CAS 1196152-87-0

:

3-(Trifluoromethyl)-1,2,4-oxadiazole-5-carboxaldehyde

Description:
3-(Trifluoromethyl)-1,2,4-oxadiazole-5-carboxaldehyde is a heterocyclic organic compound characterized by the presence of a trifluoromethyl group and an oxadiazole ring. The oxadiazole moiety consists of five members, including two nitrogen atoms and three carbon atoms, contributing to its unique chemical properties. The trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity. The aldehyde functional group at the 5-position of the oxadiazole ring makes it a potential candidate for further chemical modifications, allowing for the synthesis of various derivatives. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and material science. Its stability, solubility, and reactivity can be influenced by the presence of the trifluoromethyl group, which is known to impart unique electronic properties. Overall, 3-(Trifluoromethyl)-1,2,4-oxadiazole-5-carboxaldehyde is a versatile compound with potential applications in various fields, including agrochemicals and pharmaceuticals.
Formula:C4HF3N2O2
InChI:InChI=1S/C4HF3N2O2/c5-4(6,7)3-8-2(1-10)11-9-3/h1H
InChI key:InChIKey=RJBNATIWUPQHKP-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(C=O)ON1
Synonyms:
  • 1,2,4-Oxadiazole-5-carboxaldehyde, 3-(trifluoromethyl)-
  • 3-(Trifluoromethyl)-1,2,4-oxadiazole-5-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.