CAS 1196153-19-1

7,8-Dihydro-5H-pyrano[4,3-b]pyridine-3-sulfonyl chloride

Description:

7,8-Dihydro-5H-pyrano[4,3-b]pyridine-3-sulfonyl chloride is a chemical compound characterized by its unique bicyclic structure, which combines elements of pyridine and pyran. This compound features a sulfonyl chloride functional group, making it a reactive species often used in organic synthesis. The presence of the sulfonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it valuable for introducing sulfonyl functionalities into other molecules. The bicyclic nature of the compound contributes to its potential biological activity, as many pyridine derivatives are known for their pharmacological properties. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in synthetic chemistry. Overall, 7,8-Dihydro-5H-pyrano[4,3-b]pyridine-3-sulfonyl chloride is a versatile intermediate in the synthesis of more complex organic compounds, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₈H₈ClNO₃S

InChI: InChI=1S/C8H8ClNO3S/c9-14(11,12)7-3-6-5-13-2-1-8(6)10-4-7/h3-4H,1-2,5H2

InChI key: InChIKey=JOPNKFRSZPJNHG-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C=C2C(=NC1)CCOC2

Synonyms:

• 5H-Pyrano[4,3-b]pyridine-3-sulfonyl chloride, 7,8-dihydro-
• 7,8-Dihydro-5H-pyrano[4,3-b]pyridine-3-sulfonyl chloride