CAS 1196153-44-2

Pyrimidine, 5-(2-methyl-1-piperazinyl)-

Description:

Pyrimidine, 5-(2-methyl-1-piperazinyl)- is a heterocyclic organic compound characterized by the presence of a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The compound features a piperazine moiety, specifically a 2-methyl-1-piperazinyl group, which contributes to its biological activity and solubility properties. Pyrimidines are known for their role in nucleic acids and various biochemical processes. This particular compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, possibly influencing receptor binding or enzyme activity. The presence of the piperazine ring often enhances the compound's ability to cross biological membranes, which is crucial for drug development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups attached to the pyrimidine and piperazine rings. Overall, this compound represents a class of substances that may have significant implications in pharmaceutical research and development.

Formula: C₉H₁₄N₄

InChI: InChI=1S/C9H14N4/c1-8-4-10-2-3-13(8)9-5-11-7-12-6-9/h5-8,10H,2-4H2,1H3

InChI key: InChIKey=RYAAZLYGUWVGSQ-UHFFFAOYSA-N

SMILES: CC1N(C=2C=NC=NC2)CCNC1

Synonyms:

• Pyrimidine, 5-(2-methyl-1-piperazinyl)-
• 5-(2-Methylpiperazin-1-yl)pyrimidine